C11H10FN3S — CID 84616997
4-[(6-fluoro-1H-benzimidazol-2-yl)sulfanyl]butanenitrile (PubChem CID 84616997) has the molecular formula C11H10FN3S and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-[(6-fluoro-1H-benzimidazol-2-yl)sulfanyl]butanenitrile.
| Compound Name | 4-[(6-fluoro-1H-benzimidazol-2-yl)sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 84616997 |
| Molecular Formula | C11H10FN3S |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 4-[(6-fluoro-1H-benzimidazol-2-yl)sulfanyl]butanenitrile |
| SMILES | N#CCCCSc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C11H10FN3S/c12-8-3-4-9-10(7-8)15-11(14-9)16-6-2-1-5-13/h3-4,7H,1-2,6H2,(H,14,15) |
| InChIKey | IMQMEQRMWQGPRO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|