C12H10F2N4O2S — CID 39042087
3-[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]ethyl]imidazolidine-2,4-dione (PubChem CID 39042087) has the molecular formula C12H10F2N4O2S and a molecular weight of 312.30 g/mol. Its IUPAC name is 3-[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 39042087 |
| Molecular Formula | C12H10F2N4O2S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 3-[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCSc1nc2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C12H10F2N4O2S/c13-6-3-8-9(4-7(6)14)17-11(16-8)21-2-1-18-10(19)5-15-12(18)20/h3-4H,1-2,5H2,(H,15,20)(H,16,17) |
| InChIKey | XGRVMQKQJNEASC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|