C35H28N4O4 — CID 175083414
(1,2,6,7-tetraisocyanato-1,7,7-triphenylheptyl)benzene (PubChem CID 175083414) has the molecular formula C35H28N4O4 and a molecular weight of 568.63 g/mol. Its IUPAC name is (1,2,6,7-tetraisocyanato-1,7,7-triphenylheptyl)benzene.
| Compound Name | (1,2,6,7-tetraisocyanato-1,7,7-triphenylheptyl)benzene |
|---|---|
| PubChem CID | 175083414 |
| Molecular Formula | C35H28N4O4 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | (1,2,6,7-tetraisocyanato-1,7,7-triphenylheptyl)benzene |
| SMILES | O=C=NC(CCCC(N=C=O)C(N=C=O)(c1ccccc1)c1ccccc1)C(N=C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H28N4O4/c40-24-36-32(34(38-26-42,28-14-5-1-6-15-28)29-16-7-2-8-17-29)22-13-23-33(37-25-41)35(39-27-43,30-18-9-3-10-19-30)31-20-11-4-12-21-31/h1-12,14-21,32-33H,13,22-23H2 |
| InChIKey | SMJUXAFICVQZSV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|