C16H27NO2 — CID 175083998
tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate (PubChem CID 175083998) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175083998 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate |
| SMILES | C#CCCCC1CN(C)C(C)(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27NO2/c1-7-8-9-10-13-11-16(5,17(6)12-13)14(18)19-15(2,3)4/h1,13H,8-12H2,2-6H3 |
| InChIKey | LZPSAPYAAIMEGE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|