tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate

C16H27NO2 — CID 175083998

IUPACtert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate
SMILESC#CCCCC1CN(C)C(C)(C(=O)OC(C)(C)C)C1
InChIInChI=1S/C16H27NO2/c1-7-8-9-10-13-11-16(5,17(6)12-13)14(18)19-15(2,3)4/h1,13H,8-12H2,2-6H3
InChIKeyLZPSAPYAAIMEGE-UHFFFAOYSA-N
MW265.40 g/mol
LogP2.84
Rot. Bonds4

About tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate

tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate (PubChem CID 175083998) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate.

Molecular Properties

Compound Nametert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate
PubChem CID175083998
Molecular FormulaC16H27NO2
Molecular Weight265.40 g/mol
Exact Mass265.20
IUPAC Nametert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate
SMILESC#CCCCC1CN(C)C(C)(C(=O)OC(C)(C)C)C1
InChIInChI=1S/C16H27NO2/c1-7-8-9-10-13-11-16(5,17(6)12-13)14(18)19-15(2,3)4/h1,13H,8-12H2,2-6H3
InChIKeyLZPSAPYAAIMEGE-UHFFFAOYSA-N
XLogP2.84
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.40
LogP ≤ 52.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate?
The IUPAC name of tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate (CID 175083998) is tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate.
What is the SMILES notation for tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate?
The canonical SMILES for tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate is C#CCCCC1CN(C)C(C)(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate?
The InChIKey is LZPSAPYAAIMEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2/c1-7-8-9-10-13-11-16(5,17(6)12-13)14(18)19-15(2,3)4/h1,13H,8-12H2,2-6H3.
What are the key properties of tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate?
tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate has a molecular weight of 265.40 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1,2-dimethyl-4-pent-4-ynylpyrrolidine-2-carboxylate is sourced from PubChem (CID 175083998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).