C25H31N5O — CID 175084934
6-[[(1-tert-butylpyrrolidin-3-yl)amino]methyl]-5-(4-phenoxyphenyl)pyrimidin-4-amine (PubChem CID 175084934) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 6-[[(1-tert-butylpyrrolidin-3-yl)amino]methyl]-5-(4-phenoxyphenyl)pyrimidin-4-amine.
| Compound Name | 6-[[(1-tert-butylpyrrolidin-3-yl)amino]methyl]-5-(4-phenoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 175084934 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 6-[[(1-tert-butylpyrrolidin-3-yl)amino]methyl]-5-(4-phenoxyphenyl)pyrimidin-4-amine |
| SMILES | CC(C)(C)N1CCC(NCc2ncnc(N)c2-c2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H31N5O/c1-25(2,3)30-14-13-19(16-30)27-15-22-23(24(26)29-17-28-22)18-9-11-21(12-10-18)31-20-7-5-4-6-8-20/h4-12,17,19,27H,13-16H2,1-3H3,(H2,26,28,29) |
| InChIKey | GVKYPPJHGNHZNR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |