C22H25NO4 — CID 175088593
3-(2-hydroxybenzoyl)-1-(4-methoxyphenyl)-4,4,6-trimethylpiperidin-2-one (PubChem CID 175088593) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-(2-hydroxybenzoyl)-1-(4-methoxyphenyl)-4,4,6-trimethylpiperidin-2-one.
| Compound Name | 3-(2-hydroxybenzoyl)-1-(4-methoxyphenyl)-4,4,6-trimethylpiperidin-2-one |
|---|---|
| PubChem CID | 175088593 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-(2-hydroxybenzoyl)-1-(4-methoxyphenyl)-4,4,6-trimethylpiperidin-2-one |
| SMILES | COc1ccc(N2C(=O)C(C(=O)c3ccccc3O)C(C)(C)CC2C)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-14-13-22(2,3)19(20(25)17-7-5-6-8-18(17)24)21(26)23(14)15-9-11-16(27-4)12-10-15/h5-12,14,19,24H,13H2,1-4H3 |
| InChIKey | WWLPIKKGMBHHND-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|