C24H26ClN3 — CID 175090302
4-[[4-[(chloroamino)methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline (PubChem CID 175090302) has the molecular formula C24H26ClN3 and a molecular weight of 391.95 g/mol. Its IUPAC name is 4-[[4-[(chloroamino)methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-[(chloroamino)methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 175090302 |
| Molecular Formula | C24H26ClN3 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-[[4-[(chloroamino)methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)=c2ccc(=CNCl)cc2)cc1 |
| InChI | InChI=1S/C24H26ClN3/c1-27(2)22-13-9-20(10-14-22)24(19-7-5-18(6-8-19)17-26-25)21-11-15-23(16-12-21)28(3)4/h5-17,26H,1-4H3 |
| InChIKey | CUHPDZFOOJIKBJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|