C8H11ClN2 — CID 89056981
1-N-chloro-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 89056981) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 1-N-chloro-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-chloro-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 89056981 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 1-N-chloro-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NCl)cc1 |
| InChI | InChI=1S/C8H11ClN2/c1-11(2)8-5-3-7(10-9)4-6-8/h3-6,10H,1-2H3 |
| InChIKey | PZMUBIKRTRXPEE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|