C25H33ClN6 — CID 140531213
1-chloro-N,N',N"-tris[4-(dimethylamino)phenyl]methanetriamine (PubChem CID 140531213) has the molecular formula C25H33ClN6 and a molecular weight of 453.03 g/mol. Its IUPAC name is 1-chloro-N,N',N"-tris[4-(dimethylamino)phenyl]methanetriamine.
| Compound Name | 1-chloro-N,N',N"-tris[4-(dimethylamino)phenyl]methanetriamine |
|---|---|
| PubChem CID | 140531213 |
| Molecular Formula | C25H33ClN6 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 1-chloro-N,N',N"-tris[4-(dimethylamino)phenyl]methanetriamine |
| SMILES | CN(C)c1ccc(NC(Cl)(Nc2ccc(N(C)C)cc2)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H33ClN6/c1-30(2)22-13-7-19(8-14-22)27-25(26,28-20-9-15-23(16-10-20)31(3)4)29-21-11-17-24(18-12-21)32(5)6/h7-18,27-29H,1-6H3 |
| InChIKey | HZOKVFJBNDFFDZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|