C32H26F2N4O5 — CID 175091106
3-acetyl-7-[[4-[2-[(2,4-difluorophenyl)methoxy]phenyl]pyrimidin-2-yl]amino]-4-morpholin-2-ylchromen-2-one (PubChem CID 175091106) has the molecular formula C32H26F2N4O5 and a molecular weight of 584.58 g/mol. Its IUPAC name is 3-acetyl-7-[[4-[2-[(2,4-difluorophenyl)methoxy]phenyl]pyrimidin-2-yl]amino]-4-morpholin-2-ylchromen-2-one.
| Compound Name | 3-acetyl-7-[[4-[2-[(2,4-difluorophenyl)methoxy]phenyl]pyrimidin-2-yl]amino]-4-morpholin-2-ylchromen-2-one |
|---|---|
| PubChem CID | 175091106 |
| Molecular Formula | C32H26F2N4O5 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 3-acetyl-7-[[4-[2-[(2,4-difluorophenyl)methoxy]phenyl]pyrimidin-2-yl]amino]-4-morpholin-2-ylchromen-2-one |
| SMILES | CC(=O)c1c(C2CNCCO2)c2ccc(Nc3nccc(-c4ccccc4OCc4ccc(F)cc4F)n3)cc2oc1=O |
| InChI | InChI=1S/C32H26F2N4O5/c1-18(39)29-30(28-16-35-12-13-41-28)23-9-8-21(15-27(23)43-31(29)40)37-32-36-11-10-25(38-32)22-4-2-3-5-26(22)42-17-19-6-7-20(33)14-24(19)34/h2-11,14-15,28,35H,12-13,16-17H2,1H3,(H,36,37,38) |
| InChIKey | GNJMYFGQSKIKLB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|