C27H23ClFN3O5 — CID 175080333
3-acetyl-7-[[5-chloro-4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]amino]-4-morpholin-2-ylchromen-2-one (PubChem CID 175080333) has the molecular formula C27H23ClFN3O5 and a molecular weight of 523.95 g/mol. Its IUPAC name is 3-acetyl-7-[[5-chloro-4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]amino]-4-morpholin-2-ylchromen-2-one.
| Compound Name | 3-acetyl-7-[[5-chloro-4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]amino]-4-morpholin-2-ylchromen-2-one |
|---|---|
| PubChem CID | 175080333 |
| Molecular Formula | C27H23ClFN3O5 |
| Molecular Weight | 523.95 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 3-acetyl-7-[[5-chloro-4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]amino]-4-morpholin-2-ylchromen-2-one |
| SMILES | COc1cc(F)ccc1-c1cc(Nc2ccc3c(C4CNCCO4)c(C(C)=O)c(=O)oc3c2)ncc1Cl |
| InChI | InChI=1S/C27H23ClFN3O5/c1-14(33)25-26(23-13-30-7-8-36-23)18-6-4-16(10-22(18)37-27(25)34)32-24-11-19(20(28)12-31-24)17-5-3-15(29)9-21(17)35-2/h3-6,9-12,23,30H,7-8,13H2,1-2H3,(H,31,32) |
| InChIKey | HPPFXGWGYVRELD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.95 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|