C21H15AuCl3N4 — CID 175091649
chloroform;21,22-dihydroporphyrin;gold (PubChem CID 175091649) has the molecular formula C21H15AuCl3N4 and a molecular weight of 626.71 g/mol. Its IUPAC name is chloroform;21,22-dihydroporphyrin;gold.
| Compound Name | chloroform;21,22-dihydroporphyrin;gold |
|---|---|
| PubChem CID | 175091649 |
| Molecular Formula | C21H15AuCl3N4 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 625.00 |
| IUPAC Name | chloroform;21,22-dihydroporphyrin;gold |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.ClC(Cl)Cl.[Au] |
| InChI | InChI=1S/C20H14N4.CHCl3.Au/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;2-1(3)4;/h1-12,21-22H;1H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | WJJZYVKAVDKFDR-IAULSPAKSA-N |
| XLogP | 6.64 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|