C29H32BrN3O3 — CID 175094049
[2-[1-[2-[[4-(bromomethyl)benzoyl]-methylamino]ethyl]piperidin-4-yl]-6-phenylphenyl]carbamic acid (PubChem CID 175094049) has the molecular formula C29H32BrN3O3 and a molecular weight of 550.50 g/mol. Its IUPAC name is [2-[1-[2-[[4-(bromomethyl)benzoyl]-methylamino]ethyl]piperidin-4-yl]-6-phenylphenyl]carbamic acid.
| Compound Name | [2-[1-[2-[[4-(bromomethyl)benzoyl]-methylamino]ethyl]piperidin-4-yl]-6-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 175094049 |
| Molecular Formula | C29H32BrN3O3 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | [2-[1-[2-[[4-(bromomethyl)benzoyl]-methylamino]ethyl]piperidin-4-yl]-6-phenylphenyl]carbamic acid |
| SMILES | CN(CCN1CCC(c2cccc(-c3ccccc3)c2NC(=O)O)CC1)C(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C29H32BrN3O3/c1-32(28(34)24-12-10-21(20-30)11-13-24)18-19-33-16-14-23(15-17-33)26-9-5-8-25(27(26)31-29(35)36)22-6-3-2-4-7-22/h2-13,23,31H,14-20H2,1H3,(H,35,36) |
| InChIKey | YXMZFAPDTUABGK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|