C27H40Cl2N4O3 — CID 66793885
[2-[1-[2-[6-aminohexanoyl(methyl)amino]ethyl]piperidin-4-yl]-6-phenylphenyl]carbamic acid;dihydrochloride (PubChem CID 66793885) has the molecular formula C27H40Cl2N4O3 and a molecular weight of 539.55 g/mol. Its IUPAC name is [2-[1-[2-[6-aminohexanoyl(methyl)amino]ethyl]piperidin-4-yl]-6-phenylphenyl]carbamic acid;dihydrochloride.
| Compound Name | [2-[1-[2-[6-aminohexanoyl(methyl)amino]ethyl]piperidin-4-yl]-6-phenylphenyl]carbamic acid;dihydrochloride |
|---|---|
| PubChem CID | 66793885 |
| Molecular Formula | C27H40Cl2N4O3 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | [2-[1-[2-[6-aminohexanoyl(methyl)amino]ethyl]piperidin-4-yl]-6-phenylphenyl]carbamic acid;dihydrochloride |
| SMILES | CN(CCN1CCC(c2cccc(-c3ccccc3)c2NC(=O)O)CC1)C(=O)CCCCCN.Cl.Cl |
| InChI | InChI=1S/C27H38N4O3.2ClH/c1-30(25(32)13-6-3-7-16-28)19-20-31-17-14-22(15-18-31)24-12-8-11-23(26(24)29-27(33)34)21-9-4-2-5-10-21;;/h2,4-5,8-12,22,29H,3,6-7,13-20,28H2,1H3,(H,33,34);2*1H |
| InChIKey | NTLIKEBATVOMRY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|