C28H39N5O3S — CID 87153646
[1-[2-[6-(carbamothioylamino)hexanoyl-methylamino]ethyl]piperidin-4-yl]-(2-phenylphenyl)carbamic acid (PubChem CID 87153646) has the molecular formula C28H39N5O3S and a molecular weight of 525.72 g/mol. Its IUPAC name is [1-[2-[6-(carbamothioylamino)hexanoyl-methylamino]ethyl]piperidin-4-yl]-(2-phenylphenyl)carbamic acid.
| Compound Name | [1-[2-[6-(carbamothioylamino)hexanoyl-methylamino]ethyl]piperidin-4-yl]-(2-phenylphenyl)carbamic acid |
|---|---|
| PubChem CID | 87153646 |
| Molecular Formula | C28H39N5O3S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | [1-[2-[6-(carbamothioylamino)hexanoyl-methylamino]ethyl]piperidin-4-yl]-(2-phenylphenyl)carbamic acid |
| SMILES | CN(CCN1CCC(N(C(=O)O)c2ccccc2-c2ccccc2)CC1)C(=O)CCCCCNC(N)=S |
| InChI | InChI=1S/C28H39N5O3S/c1-31(26(34)14-6-3-9-17-30-27(29)37)20-21-32-18-15-23(16-19-32)33(28(35)36)25-13-8-7-12-24(25)22-10-4-2-5-11-22/h2,4-5,7-8,10-13,23H,3,6,9,14-21H2,1H3,(H,35,36)(H3,29,30,37) |
| InChIKey | POHREBHSMLIOHN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|