About cyclobutylpentazolidine
cyclobutylpentazolidine (PubChem CID 175094284) has the molecular formula C4H11N5
and a molecular weight of 129.17 g/mol. Its IUPAC name is cyclobutylpentazolidine.
Molecular Properties
| Compound Name | cyclobutylpentazolidine |
| PubChem CID | 175094284 |
| Molecular Formula | C4H11N5 |
| Molecular Weight | 129.17 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | cyclobutylpentazolidine |
| SMILES | C1CC(n2[nH][nH][nH][nH]2)C1 |
| InChI | InChI=1S/C4H11N5/c1-2-4(3-1)9-7-5-6-8-9/h4-8H,1-3H2 |
| InChIKey | WEZUOOFRMBQHRB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclobutylpentazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylpentazolidine?
The IUPAC name of cyclobutylpentazolidine (CID 175094284) is cyclobutylpentazolidine.
What is the SMILES notation for cyclobutylpentazolidine?
The canonical SMILES for cyclobutylpentazolidine is C1CC(n2[nH][nH][nH][nH]2)C1.
What is the InChIKey of cyclobutylpentazolidine?
The InChIKey is WEZUOOFRMBQHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N5/c1-2-4(3-1)9-7-5-6-8-9/h4-8H,1-3H2.
What are the key properties of cyclobutylpentazolidine?
cyclobutylpentazolidine has a molecular weight of 129.17 g/mol, XLogP of 0.65, 1 rotatable bonds, 4 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylpentazolidine is sourced from PubChem (CID 175094284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).