C14H12FN3O3 — CID 175096326
4-(4-amino-2-fluorophenoxy)-2,3-dihydropyrrolo[2,3-b]pyridine-1-carboxylic acid (PubChem CID 175096326) has the molecular formula C14H12FN3O3 and a molecular weight of 289.27 g/mol. Its IUPAC name is 4-(4-amino-2-fluorophenoxy)-2,3-dihydropyrrolo[2,3-b]pyridine-1-carboxylic acid.
| Compound Name | 4-(4-amino-2-fluorophenoxy)-2,3-dihydropyrrolo[2,3-b]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 175096326 |
| Molecular Formula | C14H12FN3O3 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-(4-amino-2-fluorophenoxy)-2,3-dihydropyrrolo[2,3-b]pyridine-1-carboxylic acid |
| SMILES | Nc1ccc(Oc2ccnc3c2CCN3C(=O)O)c(F)c1 |
| InChI | InChI=1S/C14H12FN3O3/c15-10-7-8(16)1-2-12(10)21-11-3-5-17-13-9(11)4-6-18(13)14(19)20/h1-3,5,7H,4,6,16H2,(H,19,20) |
| InChIKey | QRDDXEFXISGOFX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|