C16H21NO5 — CID 175104464
[1-(7-methyl-3-methylidene-2-oxo-4,7,8,8a-tetrahydro-3aH-furo[2,3-b]azepin-6-yl)-3-oxobutyl] acetate (PubChem CID 175104464) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is [1-(7-methyl-3-methylidene-2-oxo-4,7,8,8a-tetrahydro-3aH-furo[2,3-b]azepin-6-yl)-3-oxobutyl] acetate.
| Compound Name | [1-(7-methyl-3-methylidene-2-oxo-4,7,8,8a-tetrahydro-3aH-furo[2,3-b]azepin-6-yl)-3-oxobutyl] acetate |
|---|---|
| PubChem CID | 175104464 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [1-(7-methyl-3-methylidene-2-oxo-4,7,8,8a-tetrahydro-3aH-furo[2,3-b]azepin-6-yl)-3-oxobutyl] acetate |
| SMILES | C=C1C(=O)OC2NC(C)C(C(CC(C)=O)OC(C)=O)=CCC12 |
| InChI | InChI=1S/C16H21NO5/c1-8(18)7-14(21-11(4)19)13-6-5-12-9(2)16(20)22-15(12)17-10(13)3/h6,10,12,14-15,17H,2,5,7H2,1,3-4H3 |
| InChIKey | VDMPZJZGEHDLTI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|