C18H20N4O2 — CID 175107019
3-(4-methoxy-N-methylanilino)-5-morpholin-4-ylpyridine-2-carbonitrile (PubChem CID 175107019) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(4-methoxy-N-methylanilino)-5-morpholin-4-ylpyridine-2-carbonitrile.
| Compound Name | 3-(4-methoxy-N-methylanilino)-5-morpholin-4-ylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 175107019 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-(4-methoxy-N-methylanilino)-5-morpholin-4-ylpyridine-2-carbonitrile |
| SMILES | COc1ccc(N(C)c2cc(N3CCOCC3)cnc2C#N)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-21(14-3-5-16(23-2)6-4-14)18-11-15(13-20-17(18)12-19)22-7-9-24-10-8-22/h3-6,11,13H,7-10H2,1-2H3 |
| InChIKey | JCHKHTYIENVZBR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |