C14H21O14P3Si — CID 175107742
dimethyl [phenoxy(phosphonooxy)phosphoryl] phosphate;trihydroxy(phenoxy)silane (PubChem CID 175107742) has the molecular formula C14H21O14P3Si and a molecular weight of 534.32 g/mol. Its IUPAC name is dimethyl [phenoxy(phosphonooxy)phosphoryl] phosphate;trihydroxy(phenoxy)silane.
| Compound Name | dimethyl [phenoxy(phosphonooxy)phosphoryl] phosphate;trihydroxy(phenoxy)silane |
|---|---|
| PubChem CID | 175107742 |
| Molecular Formula | C14H21O14P3Si |
| Molecular Weight | 534.32 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | dimethyl [phenoxy(phosphonooxy)phosphoryl] phosphate;trihydroxy(phenoxy)silane |
| SMILES | COP(=O)(OC)OP(=O)(Oc1ccccc1)OP(=O)(O)O.O[Si](O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C8H13O10P3.C6H8O4Si/c1-14-20(12,15-2)18-21(13,17-19(9,10)11)16-8-6-4-3-5-7-8;7-11(8,9)10-6-4-2-1-3-5-6/h3-7H,1-2H3,(H2,9,10,11);1-5,7-9H |
| InChIKey | AFEXOKCYDJZOAE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 207.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|