C25H30F2N4O2 — CID 175108171
3-[[1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]amino]propylcarbamic acid (PubChem CID 175108171) has the molecular formula C25H30F2N4O2 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-[[1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]amino]propylcarbamic acid.
| Compound Name | 3-[[1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 175108171 |
| Molecular Formula | C25H30F2N4O2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-[[1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]amino]propylcarbamic acid |
| SMILES | CC(C)(C)C(NCCCNC(=O)O)c1nc(-c2cc(F)ccc2F)cn1Cc1ccccc1 |
| InChI | InChI=1S/C25H30F2N4O2/c1-25(2,3)22(28-12-7-13-29-24(32)33)23-30-21(19-14-18(26)10-11-20(19)27)16-31(23)15-17-8-5-4-6-9-17/h4-6,8-11,14,16,22,28-29H,7,12-13,15H2,1-3H3,(H,32,33) |
| InChIKey | GZNCACGORJLFFZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|