C23H23F2N3O2 — CID 90458663
[1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylbut-3-enyl]carbamic acid (PubChem CID 90458663) has the molecular formula C23H23F2N3O2 and a molecular weight of 411.45 g/mol. Its IUPAC name is [1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylbut-3-enyl]carbamic acid.
| Compound Name | [1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylbut-3-enyl]carbamic acid |
|---|---|
| PubChem CID | 90458663 |
| Molecular Formula | C23H23F2N3O2 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylbut-3-enyl]carbamic acid |
| SMILES | C=CC(C)(C)C(NC(=O)O)c1nc(-c2cc(F)ccc2F)cn1Cc1ccccc1 |
| InChI | InChI=1S/C23H23F2N3O2/c1-4-23(2,3)20(27-22(29)30)21-26-19(17-12-16(24)10-11-18(17)25)14-28(21)13-15-8-6-5-7-9-15/h4-12,14,20,27H,1,13H2,2-3H3,(H,29,30) |
| InChIKey | HLSAHDCQFMTAKK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|