C20H16ClNO5S — CID 175108437
2-chloro-2-methoxy-2-[2-methoxy-4-(2-phenyl-1,3-thiazole-4-carbonyl)phenyl]acetic acid (PubChem CID 175108437) has the molecular formula C20H16ClNO5S and a molecular weight of 417.87 g/mol. Its IUPAC name is 2-chloro-2-methoxy-2-[2-methoxy-4-(2-phenyl-1,3-thiazole-4-carbonyl)phenyl]acetic acid.
| Compound Name | 2-chloro-2-methoxy-2-[2-methoxy-4-(2-phenyl-1,3-thiazole-4-carbonyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 175108437 |
| Molecular Formula | C20H16ClNO5S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2-chloro-2-methoxy-2-[2-methoxy-4-(2-phenyl-1,3-thiazole-4-carbonyl)phenyl]acetic acid |
| SMILES | COc1cc(C(=O)c2csc(-c3ccccc3)n2)ccc1C(Cl)(OC)C(=O)O |
| InChI | InChI=1S/C20H16ClNO5S/c1-26-16-10-13(8-9-14(16)20(21,27-2)19(24)25)17(23)15-11-28-18(22-15)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,24,25) |
| InChIKey | IAAVFIUXBBJFEK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|