About potassium;1-aminopropan-2-ol;hydroxide
potassium;1-aminopropan-2-ol;hydroxide (PubChem CID 175114009) has the molecular formula C3H10KNO2
and a molecular weight of 131.22 g/mol. Its IUPAC name is potassium;1-aminopropan-2-ol;hydroxide.
Molecular Properties
| Compound Name | potassium;1-aminopropan-2-ol;hydroxide |
| PubChem CID | 175114009 |
| Molecular Formula | C3H10KNO2 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | potassium;1-aminopropan-2-ol;hydroxide |
| SMILES | CC(O)CN.[K+].[OH-] |
| InChI | InChI=1S/C3H9NO.K.H2O/c1-3(5)2-4;;/h3,5H,2,4H2,1H3;;1H2/q;+1;/p-1 |
| InChIKey | YQHMWZYOJYSFSD-UHFFFAOYSA-M |
| XLogP | -3.85 |
| TPSA | 76.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;1-aminopropan-2-ol;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-aminopropan-2-ol;hydroxide?
The IUPAC name of potassium;1-aminopropan-2-ol;hydroxide (CID 175114009) is potassium;1-aminopropan-2-ol;hydroxide.
What is the SMILES notation for potassium;1-aminopropan-2-ol;hydroxide?
The canonical SMILES for potassium;1-aminopropan-2-ol;hydroxide is CC(O)CN.[K+].[OH-].
What is the InChIKey of potassium;1-aminopropan-2-ol;hydroxide?
The InChIKey is YQHMWZYOJYSFSD-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9NO.K.H2O/c1-3(5)2-4;;/h3,5H,2,4H2,1H3;;1H2/q;+1;/p-1.
What are the key properties of potassium;1-aminopropan-2-ol;hydroxide?
potassium;1-aminopropan-2-ol;hydroxide has a molecular weight of 131.22 g/mol, XLogP of -3.85, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-aminopropan-2-ol;hydroxide is sourced from PubChem (CID 175114009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).