C9H21NO — CID 146604976
1-amino-4,6-dimethylheptan-2-ol (PubChem CID 146604976) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is 1-amino-4,6-dimethylheptan-2-ol.
| Compound Name | 1-amino-4,6-dimethylheptan-2-ol |
|---|---|
| PubChem CID | 146604976 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | 1-amino-4,6-dimethylheptan-2-ol |
| SMILES | CC(C)CC(C)CC(O)CN |
| InChI | InChI=1S/C9H21NO/c1-7(2)4-8(3)5-9(11)6-10/h7-9,11H,4-6,10H2,1-3H3 |
| InChIKey | FIQUMCOAJOEPNN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |