C11H21NO4 — CID 175116337
3,3-dimethylbutan-2-yl carbamate;2-methylprop-2-enoic acid (PubChem CID 175116337) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl carbamate;2-methylprop-2-enoic acid.
| Compound Name | 3,3-dimethylbutan-2-yl carbamate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175116337 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3,3-dimethylbutan-2-yl carbamate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC(OC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C7H15NO2.C4H6O2/c1-5(7(2,3)4)10-6(8)9;1-3(2)4(5)6/h5H,1-4H3,(H2,8,9);1H2,2H3,(H,5,6) |
| InChIKey | KCHOXIKGFYKRBS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|