About bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-)
bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-) (PubChem CID 175116621) has the molecular formula C15H18F6O6PS3Sb
and a molecular weight of 657.23 g/mol. Its IUPAC name is bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-).
Molecular Properties
| Compound Name | bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-) |
| PubChem CID | 175116621 |
| Molecular Formula | C15H18F6O6PS3Sb |
| Molecular Weight | 657.23 g/mol |
| Exact Mass | 655.89 |
| IUPAC Name | bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-) |
| SMILES | COS(=O)(=O)c1ccccc1[PH+](SC)c1ccccc1S(=O)(=O)OC.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C15H17O6PS3.6FH.Sb/c1-20-24(16,17)14-10-6-4-8-12(14)22(23-3)13-9-5-7-11-15(13)25(18,19)21-2;;;;;;;/h4-11H,1-3H3;6*1H;/q;;;;;;;+5/p-5 |
| InChIKey | CEORSJYMPOKQEI-UHFFFAOYSA-I |
| XLogP | 3.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 657.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-)?
The IUPAC name of bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-) (CID 175116621) is bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-).
What is the SMILES notation for bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-)?
The canonical SMILES for bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-) is COS(=O)(=O)c1ccccc1[PH+](SC)c1ccccc1S(=O)(=O)OC.F[Sb-](F)(F)(F)(F)F.
What is the InChIKey of bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-)?
The InChIKey is CEORSJYMPOKQEI-UHFFFAOYSA-I. The full InChI is InChI=1S/C15H17O6PS3.6FH.Sb/c1-20-24(16,17)14-10-6-4-8-12(14)22(23-3)13-9-5-7-11-15(13)25(18,19)21-2;;;;;;;/h4-11H,1-3H3;6*1H;/q;;;;;;;+5/p-5.
What are the key properties of bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-)?
bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-) has a molecular weight of 657.23 g/mol, XLogP of 3.94, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxysulfonylphenyl)-methylsulfanylphosphanium;hexafluoroantimony(1-) is sourced from PubChem (CID 175116621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).