C19H12N3NaS — CID 175118989
sodium 3-(4-cyanonaphthalen-1-yl)-1-methylpyrrolo[3,2-b]pyridine-2-thiolate (PubChem CID 175118989) has the molecular formula C19H12N3NaS and a molecular weight of 337.38 g/mol. Its IUPAC name is sodium 3-(4-cyanonaphthalen-1-yl)-1-methylpyrrolo[3,2-b]pyridine-2-thiolate.
| Compound Name | sodium 3-(4-cyanonaphthalen-1-yl)-1-methylpyrrolo[3,2-b]pyridine-2-thiolate |
|---|---|
| PubChem CID | 175118989 |
| Molecular Formula | C19H12N3NaS |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | sodium 3-(4-cyanonaphthalen-1-yl)-1-methylpyrrolo[3,2-b]pyridine-2-thiolate |
| SMILES | Cn1c([S-])c(-c2ccc(C#N)c3ccccc23)c2ncccc21.[Na+] |
| InChI | InChI=1S/C19H13N3S.Na/c1-22-16-7-4-10-21-18(16)17(19(22)23)15-9-8-12(11-20)13-5-2-3-6-14(13)15;/h2-10,23H,1H3;/q;+1/p-1 |
| InChIKey | RAJDMYNYNBRBJW-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|