C18H11N3S — CID 175121372
4-(3-sulfanylpyrrolo[2,3-b]pyridin-1-yl)naphthalene-1-carbonitrile (PubChem CID 175121372) has the molecular formula C18H11N3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-(3-sulfanylpyrrolo[2,3-b]pyridin-1-yl)naphthalene-1-carbonitrile.
| Compound Name | 4-(3-sulfanylpyrrolo[2,3-b]pyridin-1-yl)naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 175121372 |
| Molecular Formula | C18H11N3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-(3-sulfanylpyrrolo[2,3-b]pyridin-1-yl)naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(-n2cc(S)c3cccnc32)c2ccccc12 |
| InChI | InChI=1S/C18H11N3S/c19-10-12-7-8-16(14-5-2-1-4-13(12)14)21-11-17(22)15-6-3-9-20-18(15)21/h1-9,11,22H |
| InChIKey | AKXPKAOUYWMWQL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|