C19H13N3S — CID 175119270
4-(1-methyl-2-sulfanylpyrrolo[2,3-c]pyridin-3-yl)naphthalene-1-carbonitrile (PubChem CID 175119270) has the molecular formula C19H13N3S and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-(1-methyl-2-sulfanylpyrrolo[2,3-c]pyridin-3-yl)naphthalene-1-carbonitrile.
| Compound Name | 4-(1-methyl-2-sulfanylpyrrolo[2,3-c]pyridin-3-yl)naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 175119270 |
| Molecular Formula | C19H13N3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-(1-methyl-2-sulfanylpyrrolo[2,3-c]pyridin-3-yl)naphthalene-1-carbonitrile |
| SMILES | Cn1c(S)c(-c2ccc(C#N)c3ccccc23)c2ccncc21 |
| InChI | InChI=1S/C19H13N3S/c1-22-17-11-21-9-8-16(17)18(19(22)23)15-7-6-12(10-20)13-4-2-3-5-14(13)15/h2-9,11,23H,1H3 |
| InChIKey | KPSLCRVTWPOEDO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|