About 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile
4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile (PubChem CID 175122968) has the molecular formula C18H11N3S
and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile |
| PubChem CID | 175122968 |
| Molecular Formula | C18H11N3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(-n2cc(S)c3cnccc32)c2ccccc12 |
| InChI | InChI=1S/C18H11N3S/c19-9-12-5-6-16(14-4-2-1-3-13(12)14)21-11-18(22)15-10-20-8-7-17(15)21/h1-8,10-11,22H |
| InChIKey | PUKUZHMDBFFVIW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile?
The IUPAC name of 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile (CID 175122968) is 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile.
What is the SMILES notation for 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile?
The canonical SMILES for 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile is N#Cc1ccc(-n2cc(S)c3cnccc32)c2ccccc12.
What is the InChIKey of 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile?
The InChIKey is PUKUZHMDBFFVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3S/c19-9-12-5-6-16(14-4-2-1-3-13(12)14)21-11-18(22)15-10-20-8-7-17(15)21/h1-8,10-11,22H.
What are the key properties of 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile?
4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile has a molecular weight of 301.37 g/mol, XLogP of 4.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-sulfanylpyrrolo[3,2-c]pyridin-1-yl)naphthalene-1-carbonitrile is sourced from PubChem (CID 175122968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).