C30H22F3N5O2S — CID 175119675
N-methylsulfanyl-N-phenyl-3-[[3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]aniline (PubChem CID 175119675) has the molecular formula C30H22F3N5O2S and a molecular weight of 573.60 g/mol. Its IUPAC name is N-methylsulfanyl-N-phenyl-3-[[3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]aniline.
| Compound Name | N-methylsulfanyl-N-phenyl-3-[[3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 175119675 |
| Molecular Formula | C30H22F3N5O2S |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | N-methylsulfanyl-N-phenyl-3-[[3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]aniline |
| SMILES | CSN(c1ccccc1)c1cccc(Cn2nc(-c3nc(-c4ccc(OC(F)(F)F)cc4)no3)c3ccccc32)c1 |
| InChI | InChI=1S/C30H22F3N5O2S/c1-41-38(22-9-3-2-4-10-22)23-11-7-8-20(18-23)19-37-26-13-6-5-12-25(26)27(35-37)29-34-28(36-40-29)21-14-16-24(17-15-21)39-30(31,32)33/h2-18H,19H2,1H3 |
| InChIKey | ATWXUKQQRUCAMI-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|