About 1-fluoro-3-phenylbenzene;phosphane;hydrochloride
1-fluoro-3-phenylbenzene;phosphane;hydrochloride (PubChem CID 175120364) has the molecular formula C12H13ClFP
and a molecular weight of 242.66 g/mol. Its IUPAC name is 1-fluoro-3-phenylbenzene;phosphane;hydrochloride.
Molecular Properties
| Compound Name | 1-fluoro-3-phenylbenzene;phosphane;hydrochloride |
| PubChem CID | 175120364 |
| Molecular Formula | C12H13ClFP |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 1-fluoro-3-phenylbenzene;phosphane;hydrochloride |
| SMILES | Cl.Fc1cccc(-c2ccccc2)c1.P |
| InChI | InChI=1S/C12H9F.ClH.H3P/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;;/h1-9H;1H;1H3 |
| InChIKey | FOIATTIFJPBOKP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-3-phenylbenzene;phosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3-phenylbenzene;phosphane;hydrochloride?
The IUPAC name of 1-fluoro-3-phenylbenzene;phosphane;hydrochloride (CID 175120364) is 1-fluoro-3-phenylbenzene;phosphane;hydrochloride.
What is the SMILES notation for 1-fluoro-3-phenylbenzene;phosphane;hydrochloride?
The canonical SMILES for 1-fluoro-3-phenylbenzene;phosphane;hydrochloride is Cl.Fc1cccc(-c2ccccc2)c1.P.
What is the InChIKey of 1-fluoro-3-phenylbenzene;phosphane;hydrochloride?
The InChIKey is FOIATTIFJPBOKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F.ClH.H3P/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;;/h1-9H;1H;1H3.
What are the key properties of 1-fluoro-3-phenylbenzene;phosphane;hydrochloride?
1-fluoro-3-phenylbenzene;phosphane;hydrochloride has a molecular weight of 242.66 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3-phenylbenzene;phosphane;hydrochloride is sourced from PubChem (CID 175120364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).