C13H19NO2S — CID 175123055
3-(4-methylthiophen-2-yl)-3-morpholin-2-ylbutan-2-one (PubChem CID 175123055) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-(4-methylthiophen-2-yl)-3-morpholin-2-ylbutan-2-one.
| Compound Name | 3-(4-methylthiophen-2-yl)-3-morpholin-2-ylbutan-2-one |
|---|---|
| PubChem CID | 175123055 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-(4-methylthiophen-2-yl)-3-morpholin-2-ylbutan-2-one |
| SMILES | CC(=O)C(C)(c1cc(C)cs1)C1CNCCO1 |
| InChI | InChI=1S/C13H19NO2S/c1-9-6-12(17-8-9)13(3,10(2)15)11-7-14-4-5-16-11/h6,8,11,14H,4-5,7H2,1-3H3 |
| InChIKey | SMDDTQIFTKSWKM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |