C9H18O4 — CID 175123172
1-(1-hydroxypropan-2-yloxy)-4-(oxiran-2-yl)butan-2-ol (PubChem CID 175123172) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-(1-hydroxypropan-2-yloxy)-4-(oxiran-2-yl)butan-2-ol.
| Compound Name | 1-(1-hydroxypropan-2-yloxy)-4-(oxiran-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 175123172 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-(1-hydroxypropan-2-yloxy)-4-(oxiran-2-yl)butan-2-ol |
| SMILES | CC(CO)OCC(O)CCC1CO1 |
| InChI | InChI=1S/C9H18O4/c1-7(4-10)12-5-8(11)2-3-9-6-13-9/h7-11H,2-6H2,1H3 |
| InChIKey | SAMLYRZMRBANRM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|