C25H20ClF3N4OS — CID 175124432
4-chloro-N-[3-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]propyl]-3-(trifluoromethyl)benzamide (PubChem CID 175124432) has the molecular formula C25H20ClF3N4OS and a molecular weight of 516.98 g/mol. Its IUPAC name is 4-chloro-N-[3-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]propyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-chloro-N-[3-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]propyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 175124432 |
| Molecular Formula | C25H20ClF3N4OS |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 4-chloro-N-[3-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]propyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCSc1ccc2c(C=Cc3ccccn3)n[nH]c2c1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H20ClF3N4OS/c26-21-9-5-16(14-20(21)25(27,28)29)24(34)31-12-3-13-35-18-7-8-19-22(32-33-23(19)15-18)10-6-17-4-1-2-11-30-17/h1-2,4-11,14-15H,3,12-13H2,(H,31,34)(H,32,33) |
| InChIKey | FXRJDWKOEZZPLE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|