C24H25N3O4 — CID 175124711
(3S)-3-[6-[1-(benzylamino)cyclobutyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175124711) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is (3S)-3-[6-[1-(benzylamino)cyclobutyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[6-[1-(benzylamino)cyclobutyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175124711 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (3S)-3-[6-[1-(benzylamino)cyclobutyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3cc(OC4(NCc5ccccc5)CCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H25N3O4/c28-21-10-9-20(22(29)26-21)27-15-17-13-18(7-8-19(17)23(27)30)31-24(11-4-12-24)25-14-16-5-2-1-3-6-16/h1-3,5-8,13,20,25H,4,9-12,14-15H2,(H,26,28,29)/t20-/m0/s1 |
| InChIKey | DCWCIHWYNRVFFY-FQEVSTJZSA-N |
| XLogP | 2.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|