C27H32N4O4 — CID 168961894
3-[6-[(3S,4S)-4-(benzylamino)-1-ethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168961894) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-[6-[(3S,4S)-4-(benzylamino)-1-ethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3S,4S)-4-(benzylamino)-1-ethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168961894 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 3-[6-[(3S,4S)-4-(benzylamino)-1-ethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCN1CC[C@H](NCc2ccccc2)[C@@H](Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C27H32N4O4/c1-2-30-13-12-22(28-15-18-6-4-3-5-7-18)24(17-30)35-20-8-9-21-19(14-20)16-31(27(21)34)23-10-11-25(32)29-26(23)33/h3-9,14,22-24,28H,2,10-13,15-17H2,1H3,(H,29,32,33)/t22-,23?,24-/m0/s1 |
| InChIKey | OJLBOICVPBXNKM-OTKIHZFJSA-N |
| XLogP | 2.08 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|