C31H33N5O4 — CID 168961837
3-[6-[1-benzyl-4-(pyridin-2-ylmethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168961837) has the molecular formula C31H33N5O4 and a molecular weight of 539.64 g/mol. Its IUPAC name is 3-[6-[1-benzyl-4-(pyridin-2-ylmethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-benzyl-4-(pyridin-2-ylmethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168961837 |
| Molecular Formula | C31H33N5O4 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 3-[6-[1-benzyl-4-(pyridin-2-ylmethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC4CN(Cc5ccccc5)CCC4NCc4ccccn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H33N5O4/c37-29-12-11-27(30(38)34-29)36-19-22-16-24(9-10-25(22)31(36)39)40-28-20-35(18-21-6-2-1-3-7-21)15-13-26(28)33-17-23-8-4-5-14-32-23/h1-10,14,16,26-28,33H,11-13,15,17-20H2,(H,34,37,38) |
| InChIKey | YIRSESLDGUAAGR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|