C27H30F2N4O4 — CID 168961874
3-[6-[1-benzyl-4-(2,2-difluoroethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168961874) has the molecular formula C27H30F2N4O4 and a molecular weight of 512.56 g/mol. Its IUPAC name is 3-[6-[1-benzyl-4-(2,2-difluoroethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-benzyl-4-(2,2-difluoroethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168961874 |
| Molecular Formula | C27H30F2N4O4 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 3-[6-[1-benzyl-4-(2,2-difluoroethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC4CN(Cc5ccccc5)CCC4NCC(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H30F2N4O4/c28-24(29)13-30-21-10-11-32(14-17-4-2-1-3-5-17)16-23(21)37-19-6-7-20-18(12-19)15-33(27(20)36)22-8-9-25(34)31-26(22)35/h1-7,12,21-24,30H,8-11,13-16H2,(H,31,34,35) |
| InChIKey | VYBQASDYQCGBER-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|