C27H31FN4O4 — CID 168961700
3-[6-[4-(ethylamino)-1-[(4-fluorophenyl)methyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168961700) has the molecular formula C27H31FN4O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is 3-[6-[4-(ethylamino)-1-[(4-fluorophenyl)methyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(ethylamino)-1-[(4-fluorophenyl)methyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168961700 |
| Molecular Formula | C27H31FN4O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 3-[6-[4-(ethylamino)-1-[(4-fluorophenyl)methyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCNC1CCN(Cc2ccc(F)cc2)CC1Oc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H31FN4O4/c1-2-29-22-11-12-31(14-17-3-5-19(28)6-4-17)16-24(22)36-20-7-8-21-18(13-20)15-32(27(21)35)23-9-10-25(33)30-26(23)34/h3-8,13,22-24,29H,2,9-12,14-16H2,1H3,(H,30,33,34) |
| InChIKey | POEUOLFRUYVKRN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|