C26H30N4O6S — CID 169012592
N-[1-benzyl-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]piperidin-4-yl]methanesulfonamide (PubChem CID 169012592) has the molecular formula C26H30N4O6S and a molecular weight of 526.62 g/mol. Its IUPAC name is N-[1-benzyl-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-benzyl-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 169012592 |
| Molecular Formula | C26H30N4O6S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N-[1-benzyl-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(Cc2ccccc2)CC1Oc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H30N4O6S/c1-37(34,35)28-21-11-12-29(14-17-5-3-2-4-6-17)16-23(21)36-19-7-8-20-18(13-19)15-30(26(20)33)22-9-10-24(31)27-25(22)32/h2-8,13,21-23,28H,9-12,14-16H2,1H3,(H,27,31,32) |
| InChIKey | HSPPWIUBBIRTAY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|