C29H34N4O4 — CID 169012613
3-[6-[(3R,4R)-1-benzyl-4-(cyclopropylmethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169012613) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is 3-[6-[(3R,4R)-1-benzyl-4-(cyclopropylmethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3R,4R)-1-benzyl-4-(cyclopropylmethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169012613 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 3-[6-[(3R,4R)-1-benzyl-4-(cyclopropylmethylamino)piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CN(Cc5ccccc5)CC[C@H]4NCC4CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H34N4O4/c34-27-11-10-25(28(35)31-27)33-17-21-14-22(8-9-23(21)29(33)36)37-26-18-32(16-20-4-2-1-3-5-20)13-12-24(26)30-15-19-6-7-19/h1-5,8-9,14,19,24-26,30H,6-7,10-13,15-18H2,(H,31,34,35)/t24-,25?,26-/m1/s1 |
| InChIKey | DSNQILGOFGAKPE-NCKFGJJNSA-N |
| XLogP | 2.47 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|