C32H33ClN4O4 — CID 168961690
3-[6-[1-benzyl-4-[(2-chlorophenyl)methylamino]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168961690) has the molecular formula C32H33ClN4O4 and a molecular weight of 573.09 g/mol. Its IUPAC name is 3-[6-[1-benzyl-4-[(2-chlorophenyl)methylamino]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-benzyl-4-[(2-chlorophenyl)methylamino]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168961690 |
| Molecular Formula | C32H33ClN4O4 |
| Molecular Weight | 573.09 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 3-[6-[1-benzyl-4-[(2-chlorophenyl)methylamino]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC4CN(Cc5ccccc5)CCC4NCc4ccccc4Cl)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H33ClN4O4/c33-26-9-5-4-8-22(26)17-34-27-14-15-36(18-21-6-2-1-3-7-21)20-29(27)41-24-10-11-25-23(16-24)19-37(32(25)40)28-12-13-30(38)35-31(28)39/h1-11,16,27-29,34H,12-15,17-20H2,(H,35,38,39) |
| InChIKey | NDZFHEFREOIUDW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.09 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|