C32H32F2N4O4 — CID 168961683
3-[6-[(3S,4S)-4-(benzylamino)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168961683) has the molecular formula C32H32F2N4O4 and a molecular weight of 574.63 g/mol. Its IUPAC name is 3-[6-[(3S,4S)-4-(benzylamino)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3S,4S)-4-(benzylamino)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168961683 |
| Molecular Formula | C32H32F2N4O4 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 3-[6-[(3S,4S)-4-(benzylamino)-1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CN(Cc5c(F)cccc5F)CC[C@@H]4NCc4ccccc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H32F2N4O4/c33-25-7-4-8-26(34)24(25)18-37-14-13-27(35-16-20-5-2-1-3-6-20)29(19-37)42-22-9-10-23-21(15-22)17-38(32(23)41)28-11-12-30(39)36-31(28)40/h1-10,15,27-29,35H,11-14,16-19H2,(H,36,39,40)/t27-,28?,29-/m0/s1 |
| InChIKey | GWJAJTQOSWZZIY-QBGWAWDMSA-N |
| XLogP | 3.54 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|