C33H36N4O4 — CID 168961918
3-[6-[4-(benzylamino)-1-[(1R)-1-phenylethyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168961918) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-[6-[4-(benzylamino)-1-[(1R)-1-phenylethyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(benzylamino)-1-[(1R)-1-phenylethyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168961918 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 3-[6-[4-(benzylamino)-1-[(1R)-1-phenylethyl]piperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C[C@H](c1ccccc1)N1CCC(NCc2ccccc2)C(Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C33H36N4O4/c1-22(24-10-6-3-7-11-24)36-17-16-28(34-19-23-8-4-2-5-9-23)30(21-36)41-26-12-13-27-25(18-26)20-37(33(27)40)29-14-15-31(38)35-32(29)39/h2-13,18,22,28-30,34H,14-17,19-21H2,1H3,(H,35,38,39)/t22-,28?,29?,30?/m1/s1 |
| InChIKey | LMUSNQVVFZMGAD-KWAFOQKLSA-N |
| XLogP | 3.82 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|