C22H42N2O12 — CID 175127246
1,1-bis(diethylamino)ethanol;hexanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 175127246) has the molecular formula C22H42N2O12 and a molecular weight of 526.58 g/mol. Its IUPAC name is 1,1-bis(diethylamino)ethanol;hexanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1,1-bis(diethylamino)ethanol;hexanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175127246 |
| Molecular Formula | C22H42N2O12 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 1,1-bis(diethylamino)ethanol;hexanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCN(CC)C(C)(O)N(CC)CC.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C10H24N2O.C6H8O7.C6H10O4/c1-6-11(7-2)10(5,13)12(8-3)9-4;7-3(8)1-6(13,5(11)12)2-4(9)10;7-5(8)3-1-2-4-6(9)10/h13H,6-9H2,1-5H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | KIGJDCPRWXAHLR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 233.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|