C23H32N2O — CID 175130962
2-benzyl-4-(4-butylphenyl)-N,N-dimethylmorpholin-2-amine (PubChem CID 175130962) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-benzyl-4-(4-butylphenyl)-N,N-dimethylmorpholin-2-amine.
| Compound Name | 2-benzyl-4-(4-butylphenyl)-N,N-dimethylmorpholin-2-amine |
|---|---|
| PubChem CID | 175130962 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-benzyl-4-(4-butylphenyl)-N,N-dimethylmorpholin-2-amine |
| SMILES | CCCCc1ccc(N2CCOC(Cc3ccccc3)(N(C)C)C2)cc1 |
| InChI | InChI=1S/C23H32N2O/c1-4-5-9-20-12-14-22(15-13-20)25-16-17-26-23(19-25,24(2)3)18-21-10-7-6-8-11-21/h6-8,10-15H,4-5,9,16-19H2,1-3H3 |
| InChIKey | RRBQVDGDZLJJAH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|