C26H22FN3O4S — CID 175131606
methyl 5,7,11-triamino-7-(3-fluoro-2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate (PubChem CID 175131606) has the molecular formula C26H22FN3O4S and a molecular weight of 491.54 g/mol. Its IUPAC name is methyl 5,7,11-triamino-7-(3-fluoro-2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate.
| Compound Name | methyl 5,7,11-triamino-7-(3-fluoro-2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 175131606 |
| Molecular Formula | C26H22FN3O4S |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | methyl 5,7,11-triamino-7-(3-fluoro-2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate |
| SMILES | COC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1ccc(Oc2ccccc2)c(F)c1C |
| InChI | InChI=1S/C26H22FN3O4S/c1-12-14(9-11-17(20(12)27)34-13-6-4-3-5-7-13)26(30)15-8-10-16(28)22-18(15)19(21(29)24(26)31)23(35-22)25(32)33-2/h3-11,21H,28-30H2,1-2H3 |
| InChIKey | HOXAYCQKCQMMNX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|