C34H36FN5O6S2 — CID 175131630
5,7,11-triamino-7-(3-fluoro-2-methyl-4-phenoxyphenyl)-N-[1-(3-methylsulfonylpropanoyl)piperidin-3-yl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175131630) has the molecular formula C34H36FN5O6S2 and a molecular weight of 693.82 g/mol. Its IUPAC name is 5,7,11-triamino-7-(3-fluoro-2-methyl-4-phenoxyphenyl)-N-[1-(3-methylsulfonylpropanoyl)piperidin-3-yl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(3-fluoro-2-methyl-4-phenoxyphenyl)-N-[1-(3-methylsulfonylpropanoyl)piperidin-3-yl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175131630 |
| Molecular Formula | C34H36FN5O6S2 |
| Molecular Weight | 693.82 g/mol |
| Exact Mass | 693.21 |
| IUPAC Name | 5,7,11-triamino-7-(3-fluoro-2-methyl-4-phenoxyphenyl)-N-[1-(3-methylsulfonylpropanoyl)piperidin-3-yl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1c(C2(N)C(=O)C(N)c3c(C(=O)NC4CCCN(C(=O)CCS(C)(=O)=O)C4)sc4c(N)ccc2c34)ccc(Oc2ccccc2)c1F |
| InChI | InChI=1S/C34H36FN5O6S2/c1-18-21(11-13-24(28(18)35)46-20-8-4-3-5-9-20)34(38)22-10-12-23(36)30-26(22)27(29(37)32(34)42)31(47-30)33(43)39-19-7-6-15-40(17-19)25(41)14-16-48(2,44)45/h3-5,8-13,19,29H,6-7,14-17,36-38H2,1-2H3,(H,39,43) |
| InChIKey | KSBXSUGXBVNKCQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 187.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|